C15H11Cl2F3N2O2 — CID 108885341
1-[(4-chlorophenoxy)methyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea (PubChem CID 108885341) has the molecular formula C15H11Cl2F3N2O2 and a molecular weight of 379.17 g/mol. Its IUPAC name is 1-[(4-chlorophenoxy)methyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(4-chlorophenoxy)methyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 108885341 |
| Molecular Formula | C15H11Cl2F3N2O2 |
| Molecular Weight | 379.17 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 1-[(4-chlorophenoxy)methyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCOc1ccc(Cl)cc1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C15H11Cl2F3N2O2/c16-9-1-4-11(5-2-9)24-8-21-14(23)22-13-6-3-10(17)7-12(13)15(18,19)20/h1-7H,8H2,(H2,21,22,23) |
| InChIKey | ZDUATDUXEGXUFX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.17 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|