C17H16ClF3N2O2 — CID 108901052
1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[2-(3-methoxyphenyl)ethyl]urea (PubChem CID 108901052) has the molecular formula C17H16ClF3N2O2 and a molecular weight of 372.77 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[2-(3-methoxyphenyl)ethyl]urea.
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[2-(3-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108901052 |
| Molecular Formula | C17H16ClF3N2O2 |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[2-(3-methoxyphenyl)ethyl]urea |
| SMILES | COc1cccc(CCNC(=O)Nc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16ClF3N2O2/c1-25-13-4-2-3-11(9-13)7-8-22-16(24)23-15-6-5-12(18)10-14(15)17(19,20)21/h2-6,9-10H,7-8H2,1H3,(H2,22,23,24) |
| InChIKey | UJWKSZPOXFOQIE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |