C16H16ClFN2O2 — CID 108896691
1-(2-chloro-6-fluorophenyl)-3-[2-(3-methoxyphenyl)ethyl]urea (PubChem CID 108896691) has the molecular formula C16H16ClFN2O2 and a molecular weight of 322.77 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)-3-[2-(3-methoxyphenyl)ethyl]urea.
| Compound Name | 1-(2-chloro-6-fluorophenyl)-3-[2-(3-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108896691 |
| Molecular Formula | C16H16ClFN2O2 |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)-3-[2-(3-methoxyphenyl)ethyl]urea |
| SMILES | COc1cccc(CCNC(=O)Nc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C16H16ClFN2O2/c1-22-12-5-2-4-11(10-12)8-9-19-16(21)20-15-13(17)6-3-7-14(15)18/h2-7,10H,8-9H2,1H3,(H2,19,20,21) |
| InChIKey | WQCXSUCFPKQBDT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |