C14H6Br2ClF3INO — CID 4209824
3,5-dibromo-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-iodobenzamide (PubChem CID 4209824) has the molecular formula C14H6Br2ClF3INO and a molecular weight of 583.37 g/mol. Its IUPAC name is 3,5-dibromo-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-iodobenzamide.
| Compound Name | 3,5-dibromo-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 4209824 |
| Molecular Formula | C14H6Br2ClF3INO |
| Molecular Weight | 583.37 g/mol |
| Exact Mass | 580.75 |
| IUPAC Name | 3,5-dibromo-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-iodobenzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)c1cc(Br)cc(Br)c1I |
| InChI | InChI=1S/C14H6Br2ClF3INO/c15-6-3-8(12(21)10(16)4-6)13(23)22-11-2-1-7(17)5-9(11)14(18,19)20/h1-5H,(H,22,23) |
| InChIKey | HXBGSQTWLQWPNU-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.37 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|