C13H7Br3INO — CID 3465386
3,5-dibromo-N-(2-bromophenyl)-2-iodobenzamide (PubChem CID 3465386) has the molecular formula C13H7Br3INO and a molecular weight of 559.82 g/mol. Its IUPAC name is 3,5-dibromo-N-(2-bromophenyl)-2-iodobenzamide.
| Compound Name | 3,5-dibromo-N-(2-bromophenyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 3465386 |
| Molecular Formula | C13H7Br3INO |
| Molecular Weight | 559.82 g/mol |
| Exact Mass | 556.71 |
| IUPAC Name | 3,5-dibromo-N-(2-bromophenyl)-2-iodobenzamide |
| SMILES | O=C(Nc1ccccc1Br)c1cc(Br)cc(Br)c1I |
| InChI | InChI=1S/C13H7Br3INO/c14-7-5-8(12(17)10(16)6-7)13(19)18-11-4-2-1-3-9(11)15/h1-6H,(H,18,19) |
| InChIKey | VRHPSIAUUUHQPL-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.82 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|