C17H15Br2IN2O — CID 3949777
3,5-dibromo-2-iodo-N-(4-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 3949777) has the molecular formula C17H15Br2IN2O and a molecular weight of 550.03 g/mol. Its IUPAC name is 3,5-dibromo-2-iodo-N-(4-pyrrolidin-1-ylphenyl)benzamide.
| Compound Name | 3,5-dibromo-2-iodo-N-(4-pyrrolidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 3949777 |
| Molecular Formula | C17H15Br2IN2O |
| Molecular Weight | 550.03 g/mol |
| Exact Mass | 547.86 |
| IUPAC Name | 3,5-dibromo-2-iodo-N-(4-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)c1cc(Br)cc(Br)c1I |
| InChI | InChI=1S/C17H15Br2IN2O/c18-11-9-14(16(20)15(19)10-11)17(23)21-12-3-5-13(6-4-12)22-7-1-2-8-22/h3-6,9-10H,1-2,7-8H2,(H,21,23) |
| InChIKey | FJEHGUKGSYKPOL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.03 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|