C15H15IN2OS — CID 78948690
5-iodo-N-(4-pyrrolidin-1-ylphenyl)thiophene-3-carboxamide (PubChem CID 78948690) has the molecular formula C15H15IN2OS and a molecular weight of 398.27 g/mol. Its IUPAC name is 5-iodo-N-(4-pyrrolidin-1-ylphenyl)thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-(4-pyrrolidin-1-ylphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 78948690 |
| Molecular Formula | C15H15IN2OS |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 5-iodo-N-(4-pyrrolidin-1-ylphenyl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)c1csc(I)c1 |
| InChI | InChI=1S/C15H15IN2OS/c16-14-9-11(10-20-14)15(19)17-12-3-5-13(6-4-12)18-7-1-2-8-18/h3-6,9-10H,1-2,7-8H2,(H,17,19) |
| InChIKey | LAVNJXCYLKXEOO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|