C18H18Cl2N2O — CID 807268
3,4-dichloro-N-(4-piperidin-1-ylphenyl)benzamide (PubChem CID 807268) has the molecular formula C18H18Cl2N2O and a molecular weight of 349.26 g/mol. Its IUPAC name is 3,4-dichloro-N-(4-piperidin-1-ylphenyl)benzamide.
| Compound Name | 3,4-dichloro-N-(4-piperidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 807268 |
| Molecular Formula | C18H18Cl2N2O |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 3,4-dichloro-N-(4-piperidin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N2O/c19-16-9-4-13(12-17(16)20)18(23)21-14-5-7-15(8-6-14)22-10-2-1-3-11-22/h4-9,12H,1-3,10-11H2,(H,21,23) |
| InChIKey | BVXWCMAKPJGDEF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|