C24H21Cl2N3O2 — CID 1337040
N-[4-(4-benzoylpiperazin-1-yl)phenyl]-3,4-dichlorobenzamide (PubChem CID 1337040) has the molecular formula C24H21Cl2N3O2 and a molecular weight of 454.36 g/mol. Its IUPAC name is N-[4-(4-benzoylpiperazin-1-yl)phenyl]-3,4-dichlorobenzamide.
| Compound Name | N-[4-(4-benzoylpiperazin-1-yl)phenyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 1337040 |
| Molecular Formula | C24H21Cl2N3O2 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | N-[4-(4-benzoylpiperazin-1-yl)phenyl]-3,4-dichlorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccccc3)CC2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H21Cl2N3O2/c25-21-11-6-18(16-22(21)26)23(30)27-19-7-9-20(10-8-19)28-12-14-29(15-13-28)24(31)17-4-2-1-3-5-17/h1-11,16H,12-15H2,(H,27,30) |
| InChIKey | LFBAPUBCEPCDPW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|