C18H17Cl2N3O2 — CID 112981690
3,4-dichloro-N-[4-(4-formylpiperazin-1-yl)phenyl]benzamide (PubChem CID 112981690) has the molecular formula C18H17Cl2N3O2 and a molecular weight of 378.26 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-(4-formylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[4-(4-formylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 112981690 |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 3,4-dichloro-N-[4-(4-formylpiperazin-1-yl)phenyl]benzamide |
| SMILES | O=CN1CCN(c2ccc(NC(=O)c3ccc(Cl)c(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C18H17Cl2N3O2/c19-16-6-1-13(11-17(16)20)18(25)21-14-2-4-15(5-3-14)23-9-7-22(12-24)8-10-23/h1-6,11-12H,7-10H2,(H,21,25) |
| InChIKey | MZSZHRBQGBVOFT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|