C26H25Cl2N3O4 — CID 17127951
3,4-dichloro-N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 17127951) has the molecular formula C26H25Cl2N3O4 and a molecular weight of 514.41 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 17127951 |
| Molecular Formula | C26H25Cl2N3O4 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 3,4-dichloro-N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(c3ccc(NC(=O)c4ccc(Cl)c(Cl)c4)cc3)CC2)c1 |
| InChI | InChI=1S/C26H25Cl2N3O4/c1-34-21-13-18(14-22(16-21)35-2)26(33)31-11-9-30(10-12-31)20-6-4-19(5-7-20)29-25(32)17-3-8-23(27)24(28)15-17/h3-8,13-16H,9-12H2,1-2H3,(H,29,32) |
| InChIKey | GCEHEVXIULVJFO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|