C24H24BrN3O5 — CID 17128006
5-bromo-N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]furan-2-carboxamide (PubChem CID 17128006) has the molecular formula C24H24BrN3O5 and a molecular weight of 514.38 g/mol. Its IUPAC name is 5-bromo-N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17128006 |
| Molecular Formula | C24H24BrN3O5 |
| Molecular Weight | 514.38 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 5-bromo-N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]furan-2-carboxamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(c3ccc(NC(=O)c4ccc(Br)o4)cc3)CC2)c1 |
| InChI | InChI=1S/C24H24BrN3O5/c1-31-19-13-16(14-20(15-19)32-2)24(30)28-11-9-27(10-12-28)18-5-3-17(4-6-18)26-23(29)21-7-8-22(25)33-21/h3-8,13-15H,9-12H2,1-2H3,(H,26,29) |
| InChIKey | NMSQONCETWNDME-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|