C26H26IN3O4 — CID 17127949
N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]-4-iodobenzamide (PubChem CID 17127949) has the molecular formula C26H26IN3O4 and a molecular weight of 571.42 g/mol. Its IUPAC name is N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]-4-iodobenzamide.
| Compound Name | N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 17127949 |
| Molecular Formula | C26H26IN3O4 |
| Molecular Weight | 571.42 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | N-[4-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]phenyl]-4-iodobenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(c3ccc(NC(=O)c4ccc(I)cc4)cc3)CC2)c1 |
| InChI | InChI=1S/C26H26IN3O4/c1-33-23-15-19(16-24(17-23)34-2)26(32)30-13-11-29(12-14-30)22-9-7-21(8-10-22)28-25(31)18-3-5-20(27)6-4-18/h3-10,15-17H,11-14H2,1-2H3,(H,28,31) |
| InChIKey | BGUHMIJERDPZIM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|