C26H27N3O3 — CID 55917529
N-[4-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]phenyl]benzamide (PubChem CID 55917529) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[4-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]phenyl]benzamide.
| Compound Name | N-[4-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]phenyl]benzamide |
|---|---|
| PubChem CID | 55917529 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-[4-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]phenyl]benzamide |
| SMILES | COc1ccc(N2CCCN(C(=O)c3ccc(NC(=O)c4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-32-24-14-12-23(13-15-24)28-16-5-17-29(19-18-28)26(31)21-8-10-22(11-9-21)27-25(30)20-6-3-2-4-7-20/h2-4,6-15H,5,16-19H2,1H3,(H,27,30) |
| InChIKey | ZYORZNDNMOJTJE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|