C32H31N3O3 — CID 2960552
N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-4-phenylmethoxybenzamide (PubChem CID 2960552) has the molecular formula C32H31N3O3 and a molecular weight of 505.62 g/mol. Its IUPAC name is N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-4-phenylmethoxybenzamide.
| Compound Name | N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 2960552 |
| Molecular Formula | C32H31N3O3 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-4-phenylmethoxybenzamide |
| SMILES | Cc1ccc(C(=O)N2CCN(c3ccc(NC(=O)c4ccc(OCc5ccccc5)cc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H31N3O3/c1-24-7-9-27(10-8-24)32(37)35-21-19-34(20-22-35)29-15-13-28(14-16-29)33-31(36)26-11-17-30(18-12-26)38-23-25-5-3-2-4-6-25/h2-18H,19-23H2,1H3,(H,33,36) |
| InChIKey | XRNWFHIMZJQXAG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|