C29H26ClN3O3S — CID 157041394
4-[(3-chlorophenyl)methoxy]-N-[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 157041394) has the molecular formula C29H26ClN3O3S and a molecular weight of 532.07 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methoxy]-N-[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 4-[(3-chlorophenyl)methoxy]-N-[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 157041394 |
| Molecular Formula | C29H26ClN3O3S |
| Molecular Weight | 532.07 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 4-[(3-chlorophenyl)methoxy]-N-[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3cccs3)CC2)cc1)c1ccc(OCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C29H26ClN3O3S/c30-23-4-1-3-21(19-23)20-36-26-12-6-22(7-13-26)28(34)31-24-8-10-25(11-9-24)32-14-16-33(17-15-32)29(35)27-5-2-18-37-27/h1-13,18-19H,14-17,20H2,(H,31,34) |
| InChIKey | OJQOEUFRIFDEBX-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.07 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|