C24H24ClN3O2S — CID 3262820
N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-4-ethylbenzamide (PubChem CID 3262820) has the molecular formula C24H24ClN3O2S and a molecular weight of 454.00 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-4-ethylbenzamide.
| Compound Name | N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 3262820 |
| Molecular Formula | C24H24ClN3O2S |
| Molecular Weight | 454.00 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | N-[3-chloro-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)Nc2ccc(N3CCN(C(=O)c4cccs4)CC3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H24ClN3O2S/c1-2-17-5-7-18(8-6-17)23(29)26-19-9-10-21(20(25)16-19)27-11-13-28(14-12-27)24(30)22-4-3-15-31-22/h3-10,15-16H,2,11-14H2,1H3,(H,26,29) |
| InChIKey | DEVZLAXHVCNHKF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.00 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|