C23H28ClN3O2 — CID 4569965
N-[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]-4-ethylbenzamide (PubChem CID 4569965) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is N-[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]-4-ethylbenzamide.
| Compound Name | N-[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 4569965 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]-4-ethylbenzamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(NC(=O)c3ccc(CC)cc3)cc2Cl)CC1 |
| InChI | InChI=1S/C23H28ClN3O2/c1-3-5-22(28)27-14-12-26(13-15-27)21-11-10-19(16-20(21)24)25-23(29)18-8-6-17(4-2)7-9-18/h6-11,16H,3-5,12-15H2,1-2H3,(H,25,29) |
| InChIKey | ZDBQOMDDMNNDCW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|