C26H34ClN3O2 — CID 17358284
4-tert-butyl-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 17358284) has the molecular formula C26H34ClN3O2 and a molecular weight of 456.03 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 17358284 |
| Molecular Formula | C26H34ClN3O2 |
| Molecular Weight | 456.03 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 4-tert-butyl-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | CC(C)(C)C(=O)N1CCN(c2ccc(NC(=O)c3ccc(C(C)(C)C)cc3)cc2Cl)CC1 |
| InChI | InChI=1S/C26H34ClN3O2/c1-25(2,3)19-9-7-18(8-10-19)23(31)28-20-11-12-22(21(27)17-20)29-13-15-30(16-14-29)24(32)26(4,5)6/h7-12,17H,13-16H2,1-6H3,(H,28,31) |
| InChIKey | UVJBOMOYNCRSIO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.03 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|