C25H32ClN3O5 — CID 17050417
N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 17050417) has the molecular formula C25H32ClN3O5 and a molecular weight of 490.00 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 17050417 |
| Molecular Formula | C25H32ClN3O5 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(N3CCN(C(=O)C(C)(C)C)CC3)c(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H32ClN3O5/c1-25(2,3)24(31)29-11-9-28(10-12-29)19-8-7-17(15-18(19)26)27-23(30)16-13-20(32-4)22(34-6)21(14-16)33-5/h7-8,13-15H,9-12H2,1-6H3,(H,27,30) |
| InChIKey | UBYFMWLJVVGOTC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|