C21H25FN2O4 — CID 17027234
N-(3-fluoro-4-piperidin-1-ylphenyl)-3,4,5-trimethoxybenzamide (PubChem CID 17027234) has the molecular formula C21H25FN2O4 and a molecular weight of 388.44 g/mol. Its IUPAC name is N-(3-fluoro-4-piperidin-1-ylphenyl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(3-fluoro-4-piperidin-1-ylphenyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 17027234 |
| Molecular Formula | C21H25FN2O4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-(3-fluoro-4-piperidin-1-ylphenyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(N3CCCCC3)c(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C21H25FN2O4/c1-26-18-11-14(12-19(27-2)20(18)28-3)21(25)23-15-7-8-17(16(22)13-15)24-9-5-4-6-10-24/h7-8,11-13H,4-6,9-10H2,1-3H3,(H,23,25) |
| InChIKey | WRMSCESQAQZSSH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|