C19H18FN3O4 — CID 47059878
N-(3-fluoro-4-imidazol-1-ylphenyl)-3,4,5-trimethoxybenzamide (PubChem CID 47059878) has the molecular formula C19H18FN3O4 and a molecular weight of 371.37 g/mol. Its IUPAC name is N-(3-fluoro-4-imidazol-1-ylphenyl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(3-fluoro-4-imidazol-1-ylphenyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 47059878 |
| Molecular Formula | C19H18FN3O4 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-(3-fluoro-4-imidazol-1-ylphenyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(-n3ccnc3)c(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H18FN3O4/c1-25-16-8-12(9-17(26-2)18(16)27-3)19(24)22-13-4-5-15(14(20)10-13)23-7-6-21-11-23/h4-11H,1-3H3,(H,22,24) |
| InChIKey | NQPZIKYBIAPTME-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |