C22H24ClN3O4 — CID 60607880
N-(3-chloro-4-imidazol-1-ylphenyl)-3,4,5-triethoxybenzamide (PubChem CID 60607880) has the molecular formula C22H24ClN3O4 and a molecular weight of 429.90 g/mol. Its IUPAC name is N-(3-chloro-4-imidazol-1-ylphenyl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(3-chloro-4-imidazol-1-ylphenyl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 60607880 |
| Molecular Formula | C22H24ClN3O4 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-(3-chloro-4-imidazol-1-ylphenyl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(-n3ccnc3)c(Cl)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H24ClN3O4/c1-4-28-19-11-15(12-20(29-5-2)21(19)30-6-3)22(27)25-16-7-8-18(17(23)13-16)26-10-9-24-14-26/h7-14H,4-6H2,1-3H3,(H,25,27) |
| InChIKey | RAFAHSURWLWXRK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |