C14H12ClN5O2 — CID 56786021
1-(3-chloro-4-imidazol-1-ylphenyl)-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 56786021) has the molecular formula C14H12ClN5O2 and a molecular weight of 317.74 g/mol. Its IUPAC name is 1-(3-chloro-4-imidazol-1-ylphenyl)-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-(3-chloro-4-imidazol-1-ylphenyl)-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 56786021 |
| Molecular Formula | C14H12ClN5O2 |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 1-(3-chloro-4-imidazol-1-ylphenyl)-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2ccc(-n3ccnc3)c(Cl)c2)no1 |
| InChI | InChI=1S/C14H12ClN5O2/c1-9-6-13(19-22-9)18-14(21)17-10-2-3-12(11(15)7-10)20-5-4-16-8-20/h2-8H,1H3,(H2,17,18,19,21) |
| InChIKey | XEODVKFYVNRNAD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |