C14H7ClN6 — CID 168607400
2-(3-chloro-4-imidazol-1-ylanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168607400) has the molecular formula C14H7ClN6 and a molecular weight of 294.71 g/mol. Its IUPAC name is 2-(3-chloro-4-imidazol-1-ylanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(3-chloro-4-imidazol-1-ylanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607400 |
| Molecular Formula | C14H7ClN6 |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 2-(3-chloro-4-imidazol-1-ylanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(-n2ccnc2)c(Cl)c1 |
| InChI | InChI=1S/C14H7ClN6/c15-12-5-11(20-13(8-18)10(6-16)7-17)1-2-14(12)21-4-3-19-9-21/h1-5,9,20H |
| InChIKey | ZJQQMAYOQYNVOE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|