C12H6ClN5S — CID 168610671
2-chloro-4-(1,2,2-tricyanoethenylamino)benzenecarbothioamide (PubChem CID 168610671) has the molecular formula C12H6ClN5S and a molecular weight of 287.74 g/mol. Its IUPAC name is 2-chloro-4-(1,2,2-tricyanoethenylamino)benzenecarbothioamide.
| Compound Name | 2-chloro-4-(1,2,2-tricyanoethenylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 168610671 |
| Molecular Formula | C12H6ClN5S |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 2-chloro-4-(1,2,2-tricyanoethenylamino)benzenecarbothioamide |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(C(N)=S)c(Cl)c1 |
| InChI | InChI=1S/C12H6ClN5S/c13-10-3-8(1-2-9(10)12(17)19)18-11(6-16)7(4-14)5-15/h1-3,18H,(H2,17,19) |
| InChIKey | LIHHYOWAWLIWKJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|