C11H11ClN2O3S — CID 54198447
4-(4-carbamothioyl-3-chloroanilino)-4-oxobutanoic acid (PubChem CID 54198447) has the molecular formula C11H11ClN2O3S and a molecular weight of 286.74 g/mol. Its IUPAC name is 4-(4-carbamothioyl-3-chloroanilino)-4-oxobutanoic acid.
| Compound Name | 4-(4-carbamothioyl-3-chloroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54198447 |
| Molecular Formula | C11H11ClN2O3S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 4-(4-carbamothioyl-3-chloroanilino)-4-oxobutanoic acid |
| SMILES | NC(=S)c1ccc(NC(=O)CCC(=O)O)cc1Cl |
| InChI | InChI=1S/C11H11ClN2O3S/c12-8-5-6(1-2-7(8)11(13)18)14-9(15)3-4-10(16)17/h1-2,5H,3-4H2,(H2,13,18)(H,14,15)(H,16,17) |
| InChIKey | PNMTZQOXVBEPMV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|