C12H16ClN3O2 — CID 62834524
2-chloro-4-[3-(ethylamino)propanoylamino]benzamide (PubChem CID 62834524) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is 2-chloro-4-[3-(ethylamino)propanoylamino]benzamide.
| Compound Name | 2-chloro-4-[3-(ethylamino)propanoylamino]benzamide |
|---|---|
| PubChem CID | 62834524 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-chloro-4-[3-(ethylamino)propanoylamino]benzamide |
| SMILES | CCNCCC(=O)Nc1ccc(C(N)=O)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClN3O2/c1-2-15-6-5-11(17)16-8-3-4-9(12(14)18)10(13)7-8/h3-4,7,15H,2,5-6H2,1H3,(H2,14,18)(H,16,17) |
| InChIKey | JPILKKVCWGNKHY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|