C12H15ClN2O3 — CID 62834522
2-chloro-5-[3-(ethylamino)propanoylamino]benzoic acid (PubChem CID 62834522) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 2-chloro-5-[3-(ethylamino)propanoylamino]benzoic acid.
| Compound Name | 2-chloro-5-[3-(ethylamino)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 62834522 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-chloro-5-[3-(ethylamino)propanoylamino]benzoic acid |
| SMILES | CCNCCC(=O)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H15ClN2O3/c1-2-14-6-5-11(16)15-8-3-4-10(13)9(7-8)12(17)18/h3-4,7,14H,2,5-6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | WMZAFRDBOQDDRT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|