C15H21ClN2O3 — CID 65290954
5-[(6-amino-4,4-dimethylhexanoyl)amino]-2-chlorobenzoic acid (PubChem CID 65290954) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 5-[(6-amino-4,4-dimethylhexanoyl)amino]-2-chlorobenzoic acid.
| Compound Name | 5-[(6-amino-4,4-dimethylhexanoyl)amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 65290954 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 5-[(6-amino-4,4-dimethylhexanoyl)amino]-2-chlorobenzoic acid |
| SMILES | CC(C)(CCN)CCC(=O)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-15(2,7-8-17)6-5-13(19)18-10-3-4-12(16)11(9-10)14(20)21/h3-4,9H,5-8,17H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | JFCILEHCIAZZHS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |