C17H15ClF3N3O5S — CID 55641818
2-chloro-4-[3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoylamino]benzamide (PubChem CID 55641818) has the molecular formula C17H15ClF3N3O5S and a molecular weight of 465.84 g/mol. Its IUPAC name is 2-chloro-4-[3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoylamino]benzamide.
| Compound Name | 2-chloro-4-[3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoylamino]benzamide |
|---|---|
| PubChem CID | 55641818 |
| Molecular Formula | C17H15ClF3N3O5S |
| Molecular Weight | 465.84 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | 2-chloro-4-[3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoylamino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CCNS(=O)(=O)c2ccc(OC(F)(F)F)cc2)cc1Cl |
| InChI | InChI=1S/C17H15ClF3N3O5S/c18-14-9-10(1-6-13(14)16(22)26)24-15(25)7-8-23-30(27,28)12-4-2-11(3-5-12)29-17(19,20)21/h1-6,9,23H,7-8H2,(H2,22,26)(H,24,25) |
| InChIKey | ULLNKUKILNQENL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.84 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |