C17H14F6N2O4S — CID 24538040
N-[4-(trifluoromethoxy)phenyl]-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide (PubChem CID 24538040) has the molecular formula C17H14F6N2O4S and a molecular weight of 456.36 g/mol. Its IUPAC name is N-[4-(trifluoromethoxy)phenyl]-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide.
| Compound Name | N-[4-(trifluoromethoxy)phenyl]-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 24538040 |
| Molecular Formula | C17H14F6N2O4S |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | N-[4-(trifluoromethoxy)phenyl]-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1cccc(C(F)(F)F)c1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F6N2O4S/c18-16(19,20)11-2-1-3-14(10-11)30(27,28)24-9-8-15(26)25-12-4-6-13(7-5-12)29-17(21,22)23/h1-7,10,24H,8-9H2,(H,25,26) |
| InChIKey | XKQVSDKGMCEEQG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |