C13H15F3N2O5S — CID 119350481
2-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoylamino]acetic acid (PubChem CID 119350481) has the molecular formula C13H15F3N2O5S and a molecular weight of 368.33 g/mol. Its IUPAC name is 2-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoylamino]acetic acid.
| Compound Name | 2-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoylamino]acetic acid |
|---|---|
| PubChem CID | 119350481 |
| Molecular Formula | C13H15F3N2O5S |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoylamino]acetic acid |
| SMILES | O=C(O)CNC(=O)CCCNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O5S/c14-13(15,16)9-3-1-4-10(7-9)24(22,23)18-6-2-5-11(19)17-8-12(20)21/h1,3-4,7,18H,2,5-6,8H2,(H,17,19)(H,20,21) |
| InChIKey | UXIGNOLNSRUQJN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|