C10H11F3N2O3S — CID 9302241
N-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide (PubChem CID 9302241) has the molecular formula C10H11F3N2O3S and a molecular weight of 296.27 g/mol. Its IUPAC name is N-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide.
| Compound Name | N-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 9302241 |
| Molecular Formula | C10H11F3N2O3S |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | N-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
| SMILES | CNC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3N2O3S/c1-14-9(16)6-15-19(17,18)8-4-2-3-7(5-8)10(11,12)13/h2-5,15H,6H2,1H3,(H,14,16) |
| InChIKey | VUSMTAXHBWWJAN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |