C13H17F3N2O5S2 — CID 56550783
N-(2-ethylsulfonylethyl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide (PubChem CID 56550783) has the molecular formula C13H17F3N2O5S2 and a molecular weight of 402.42 g/mol. Its IUPAC name is N-(2-ethylsulfonylethyl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide.
| Compound Name | N-(2-ethylsulfonylethyl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 56550783 |
| Molecular Formula | C13H17F3N2O5S2 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | N-(2-ethylsulfonylethyl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
| SMILES | CCS(=O)(=O)CCNC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2O5S2/c1-2-24(20,21)7-6-17-12(19)9-18-25(22,23)11-5-3-4-10(8-11)13(14,15)16/h3-5,8,18H,2,6-7,9H2,1H3,(H,17,19) |
| InChIKey | GEPDAIWHDCWASP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |