C17H21F3N4O3S — CID 78780752
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide (PubChem CID 78780752) has the molecular formula C17H21F3N4O3S and a molecular weight of 418.44 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 78780752 |
| Molecular Formula | C17H21F3N4O3S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H21F3N4O3S/c1-12-9-13(2)24(23-12)8-4-7-21-16(25)11-22-28(26,27)15-6-3-5-14(10-15)17(18,19)20/h3,5-6,9-10,22H,4,7-8,11H2,1-2H3,(H,21,25) |
| InChIKey | HEIKQGNZIPVFAE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|