C16H16F6N4O — CID 19333996
1-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 19333996) has the molecular formula C16H16F6N4O and a molecular weight of 394.32 g/mol. Its IUPAC name is 1-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 19333996 |
| Molecular Formula | C16H16F6N4O |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 1-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1cc(C(F)(F)F)nn1CCCNC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F6N4O/c1-10-8-13(16(20,21)22)25-26(10)7-3-6-23-14(27)24-12-5-2-4-11(9-12)15(17,18)19/h2,4-5,8-9H,3,6-7H2,1H3,(H2,23,24,27) |
| InChIKey | NOLNLYYOCDANHN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|