C18H16F6N4O2 — CID 90486688
1-[3-(trifluoromethyl)phenyl]-3-[2-[[3-(trifluoromethyl)phenyl]carbamoylamino]ethyl]urea (PubChem CID 90486688) has the molecular formula C18H16F6N4O2 and a molecular weight of 434.34 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]-3-[2-[[3-(trifluoromethyl)phenyl]carbamoylamino]ethyl]urea.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]-3-[2-[[3-(trifluoromethyl)phenyl]carbamoylamino]ethyl]urea |
|---|---|
| PubChem CID | 90486688 |
| Molecular Formula | C18H16F6N4O2 |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]-3-[2-[[3-(trifluoromethyl)phenyl]carbamoylamino]ethyl]urea |
| SMILES | O=C(NCCNC(=O)Nc1cccc(C(F)(F)F)c1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F6N4O2/c19-17(20,21)11-3-1-5-13(9-11)27-15(29)25-7-8-26-16(30)28-14-6-2-4-12(10-14)18(22,23)24/h1-6,9-10H,7-8H2,(H2,25,27,29)(H2,26,28,30) |
| InChIKey | KQAUTFQDLXFORG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|