C8H7F3N2O2 — CID 4106892
1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 4106892) has the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. Its IUPAC name is 1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 4106892 |
| Molecular Formula | C8H7F3N2O2 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NO)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H7F3N2O2/c9-8(10,11)5-2-1-3-6(4-5)12-7(14)13-15/h1-4,15H,(H2,12,13,14) |
| InChIKey | RHKPLZXQOSKYAP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|