C22H15F6N3O2 — CID 2359720
N-[3-(trifluoromethyl)phenyl]-3-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide (PubChem CID 2359720) has the molecular formula C22H15F6N3O2 and a molecular weight of 467.37 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)phenyl]-3-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide.
| Compound Name | N-[3-(trifluoromethyl)phenyl]-3-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 2359720 |
| Molecular Formula | C22H15F6N3O2 |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-[3-(trifluoromethyl)phenyl]-3-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
| SMILES | O=C(Nc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H15F6N3O2/c23-21(24,25)14-5-2-8-17(11-14)29-19(32)13-4-1-7-16(10-13)30-20(33)31-18-9-3-6-15(12-18)22(26,27)28/h1-12H,(H,29,32)(H2,30,31,33) |
| InChIKey | QKJFBUFEEKTEFV-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |