C23H15F3N4O4 — CID 23474550
2,3-dioxo-N-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]-1,4-dihydroquinoxaline-6-carboxamide (PubChem CID 23474550) has the molecular formula C23H15F3N4O4 and a molecular weight of 468.39 g/mol. Its IUPAC name is 2,3-dioxo-N-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]-1,4-dihydroquinoxaline-6-carboxamide.
| Compound Name | 2,3-dioxo-N-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]-1,4-dihydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 23474550 |
| Molecular Formula | C23H15F3N4O4 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 2,3-dioxo-N-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]-1,4-dihydroquinoxaline-6-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1cccc(NC(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)c1 |
| InChI | InChI=1S/C23H15F3N4O4/c24-23(25,26)14-4-2-6-16(11-14)28-19(31)12-3-1-5-15(9-12)27-20(32)13-7-8-17-18(10-13)30-22(34)21(33)29-17/h1-11H,(H,27,32)(H,28,31)(H,29,33)(H,30,34) |
| InChIKey | NJHOGEHATNCVHE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|