C22H15ClF3N3O3 — CID 126224742
N-[3-[[(4-chlorobenzoyl)amino]carbamoyl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 126224742) has the molecular formula C22H15ClF3N3O3 and a molecular weight of 461.83 g/mol. Its IUPAC name is N-[3-[[(4-chlorobenzoyl)amino]carbamoyl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[[(4-chlorobenzoyl)amino]carbamoyl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 126224742 |
| Molecular Formula | C22H15ClF3N3O3 |
| Molecular Weight | 461.83 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | N-[3-[[(4-chlorobenzoyl)amino]carbamoyl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NNC(=O)c1cccc(NC(=O)c2cccc(C(F)(F)F)c2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H15ClF3N3O3/c23-17-9-7-13(8-10-17)20(31)28-29-21(32)15-4-2-6-18(12-15)27-19(30)14-3-1-5-16(11-14)22(24,25)26/h1-12H,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | FTXOLKAORQNGJK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.83 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|