C22H15F3N4O5 — CID 126231349
N-[3-[[(4-nitrobenzoyl)amino]carbamoyl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 126231349) has the molecular formula C22H15F3N4O5 and a molecular weight of 472.38 g/mol. Its IUPAC name is N-[3-[[(4-nitrobenzoyl)amino]carbamoyl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[[(4-nitrobenzoyl)amino]carbamoyl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 126231349 |
| Molecular Formula | C22H15F3N4O5 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | N-[3-[[(4-nitrobenzoyl)amino]carbamoyl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NNC(=O)c1cccc(NC(=O)c2cccc(C(F)(F)F)c2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H15F3N4O5/c23-22(24,25)16-5-1-3-14(11-16)19(30)26-17-6-2-4-15(12-17)21(32)28-27-20(31)13-7-9-18(10-8-13)29(33)34/h1-12H,(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | PBUZDNIQNATOSH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|