C22H15F3N4O4S — CID 26168227
3-[(4-nitrobenzoyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 26168227) has the molecular formula C22H15F3N4O4S and a molecular weight of 488.45 g/mol. Its IUPAC name is 3-[(4-nitrobenzoyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[(4-nitrobenzoyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26168227 |
| Molecular Formula | C22H15F3N4O4S |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 3-[(4-nitrobenzoyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H15F3N4O4S/c23-22(24,25)15-4-2-6-17(12-15)26-20(31)14-3-1-5-16(11-14)27-21(34)28-19(30)13-7-9-18(10-8-13)29(32)33/h1-12H,(H,26,31)(H2,27,28,30,34) |
| InChIKey | MXWKPQDBYBMWFT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|