C21H16F3N3OS — CID 28639160
4-(phenylcarbamothioylamino)-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 28639160) has the molecular formula C21H16F3N3OS and a molecular weight of 415.44 g/mol. Its IUPAC name is 4-(phenylcarbamothioylamino)-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-(phenylcarbamothioylamino)-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 28639160 |
| Molecular Formula | C21H16F3N3OS |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 4-(phenylcarbamothioylamino)-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccc(NC(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H16F3N3OS/c22-21(23,24)15-5-4-8-18(13-15)25-19(28)14-9-11-17(12-10-14)27-20(29)26-16-6-2-1-3-7-16/h1-13H,(H,25,28)(H2,26,27,29) |
| InChIKey | UFNVGPUGTUMCBC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|