C15H10F6N2S — CID 2803092
1,3-bis[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 2803092) has the molecular formula C15H10F6N2S and a molecular weight of 364.31 g/mol. Its IUPAC name is 1,3-bis[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1,3-bis[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2803092 |
| Molecular Formula | C15H10F6N2S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 1,3-bis[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1cccc(NC(=S)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H10F6N2S/c16-14(17,18)9-3-1-5-11(7-9)22-13(24)23-12-6-2-4-10(8-12)15(19,20)21/h1-8H,(H2,22,23,24) |
| InChIKey | OLCTWHDDTLNSNS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|