C14H12F3N3O2S2 — CID 17299540
1-(4-sulfamoylphenyl)-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 17299540) has the molecular formula C14H12F3N3O2S2 and a molecular weight of 375.40 g/mol. Its IUPAC name is 1-(4-sulfamoylphenyl)-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(4-sulfamoylphenyl)-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17299540 |
| Molecular Formula | C14H12F3N3O2S2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 1-(4-sulfamoylphenyl)-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C14H12F3N3O2S2/c15-14(16,17)9-2-1-3-11(8-9)20-13(23)19-10-4-6-12(7-5-10)24(18,21)22/h1-8H,(H2,18,21,22)(H2,19,20,23) |
| InChIKey | LGLDCRZASOCLFZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|