C14H13F2N3O3S2 — CID 4969282
1-[4-(difluoromethoxy)phenyl]-3-(3-sulfamoylphenyl)thiourea (PubChem CID 4969282) has the molecular formula C14H13F2N3O3S2 and a molecular weight of 373.41 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-(3-sulfamoylphenyl)thiourea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-(3-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 4969282 |
| Molecular Formula | C14H13F2N3O3S2 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-(3-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1cccc(NC(=S)Nc2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C14H13F2N3O3S2/c15-13(16)22-11-6-4-9(5-7-11)18-14(23)19-10-2-1-3-12(8-10)24(17,20)21/h1-8,13H,(H2,17,20,21)(H2,18,19,23) |
| InChIKey | WVHBICYNUOXRES-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|