C9H11N3O3S2 — CID 28942449
3-amino-N-(3-sulfamoylphenyl)-3-sulfanylidenepropanamide (PubChem CID 28942449) has the molecular formula C9H11N3O3S2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-amino-N-(3-sulfamoylphenyl)-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-(3-sulfamoylphenyl)-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 28942449 |
| Molecular Formula | C9H11N3O3S2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 3-amino-N-(3-sulfamoylphenyl)-3-sulfanylidenepropanamide |
| SMILES | NC(=S)CC(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H11N3O3S2/c10-8(16)5-9(13)12-6-2-1-3-7(4-6)17(11,14)15/h1-4H,5H2,(H2,10,16)(H,12,13)(H2,11,14,15) |
| InChIKey | KAQIJVIMNJOWHI-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|