C10H12N4O4S2 — CID 43316300
N-(2-amino-2-sulfanylideneethyl)-N'-(3-sulfamoylphenyl)oxamide (PubChem CID 43316300) has the molecular formula C10H12N4O4S2 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(3-sulfamoylphenyl)oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(3-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 43316300 |
| Molecular Formula | C10H12N4O4S2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(3-sulfamoylphenyl)oxamide |
| SMILES | NC(=S)CNC(=O)C(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H12N4O4S2/c11-8(19)5-13-9(15)10(16)14-6-2-1-3-7(4-6)20(12,17)18/h1-4H,5H2,(H2,11,19)(H,13,15)(H,14,16)(H2,12,17,18) |
| InChIKey | HNOAWHLWYQAZDB-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|